About 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea
1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 142651434) has the molecular formula C18H13Cl3N4O4S
and a molecular weight of 487.75 g/mol. Its IUPAC name is 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea |
| PubChem CID | 142651434 |
| Molecular Formula | C18H13Cl3N4O4S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)Nc2ccncc2)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H13Cl3N4O4S/c19-11-2-1-3-13(15(11)21)23-18(27)24-14-5-4-12(20)17(16(14)26)30(28,29)25-10-6-8-22-9-7-10/h1-9,26H,(H,22,25)(H2,23,24,27) |
| InChIKey | KHILGSZSGICHEO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea?
The IUPAC name of 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea (CID 142651434) is 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea.
What is the SMILES notation for 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea?
The canonical SMILES for 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea is O=C(Nc1ccc(Cl)c(S(=O)(=O)Nc2ccncc2)c1O)Nc1cccc(Cl)c1Cl.
What is the InChIKey of 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea?
The InChIKey is KHILGSZSGICHEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl3N4O4S/c19-11-2-1-3-13(15(11)21)23-18(27)24-14-5-4-12(20)17(16(14)26)30(28,29)25-10-6-8-22-9-7-10/h1-9,26H,(H,22,25)(H2,23,24,27).
What are the key properties of 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea?
1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea has a molecular weight of 487.75 g/mol, XLogP of 5.19, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-2-hydroxy-3-(pyridin-4-ylsulfamoyl)phenyl]-3-(2,3-dichlorophenyl)urea is sourced from PubChem (CID 142651434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).