C17H16Cl3N3O4S — CID 11662688
1-[4-chloro-3-(cyclopropylmethylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 11662688) has the molecular formula C17H16Cl3N3O4S and a molecular weight of 464.76 g/mol. Its IUPAC name is 1-[4-chloro-3-(cyclopropylmethylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[4-chloro-3-(cyclopropylmethylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 11662688 |
| Molecular Formula | C17H16Cl3N3O4S |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | 1-[4-chloro-3-(cyclopropylmethylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)NCC2CC2)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3O4S/c18-10-2-1-3-12(14(10)20)22-17(25)23-13-7-6-11(19)16(15(13)24)28(26,27)21-8-9-4-5-9/h1-3,6-7,9,21,24H,4-5,8H2,(H2,22,23,25) |
| InChIKey | XYOJBTIUANAJMO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|