C12H12Cl2N2OS — CID 80591786
1-carbamothioyl-N-(2,3-dichlorophenyl)cyclobutane-1-carboxamide (PubChem CID 80591786) has the molecular formula C12H12Cl2N2OS and a molecular weight of 303.21 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,3-dichlorophenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,3-dichlorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80591786 |
| Molecular Formula | C12H12Cl2N2OS |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 1-carbamothioyl-N-(2,3-dichlorophenyl)cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2cccc(Cl)c2Cl)CCC1 |
| InChI | InChI=1S/C12H12Cl2N2OS/c13-7-3-1-4-8(9(7)14)16-11(17)12(10(15)18)5-2-6-12/h1,3-4H,2,5-6H2,(H2,15,18)(H,16,17) |
| InChIKey | IUHSQXZFYNYNKQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|