C11H10ClIN2OS — CID 107605680
1-carbamothioyl-N-(2-chloro-4-iodophenyl)cyclopropane-1-carboxamide (PubChem CID 107605680) has the molecular formula C11H10ClIN2OS and a molecular weight of 380.64 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2-chloro-4-iodophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2-chloro-4-iodophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 107605680 |
| Molecular Formula | C11H10ClIN2OS |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 1-carbamothioyl-N-(2-chloro-4-iodophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2ccc(I)cc2Cl)CC1 |
| InChI | InChI=1S/C11H10ClIN2OS/c12-7-5-6(13)1-2-8(7)15-10(16)11(3-4-11)9(14)17/h1-2,5H,3-4H2,(H2,14,17)(H,15,16) |
| InChIKey | NTATXUZQZTXWQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|