C17H11BrF3N5OS2 — CID 10278732
N-[4-[[3-bromo-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide (PubChem CID 10278732) has the molecular formula C17H11BrF3N5OS2 and a molecular weight of 502.34 g/mol. Its IUPAC name is N-[4-[[3-bromo-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[[3-bromo-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 10278732 |
| Molecular Formula | C17H11BrF3N5OS2 |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 500.95 |
| IUPAC Name | N-[4-[[3-bromo-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2cc(Br)cc(C(F)(F)F)c2)cc1)c1csnn1 |
| InChI | InChI=1S/C17H11BrF3N5OS2/c18-10-5-9(17(19,20)21)6-13(7-10)24-16(28)23-12-3-1-11(2-4-12)22-15(27)14-8-29-26-25-14/h1-8H,(H,22,27)(H2,23,24,28) |
| InChIKey | GQFPPTDVHZMIMB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|