C20H14F6N4OS2 — CID 57124041
N-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 57124041) has the molecular formula C20H14F6N4OS2 and a molecular weight of 504.48 g/mol. Its IUPAC name is N-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 57124041 |
| Molecular Formula | C20H14F6N4OS2 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[4-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(NC(=S)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)cs1 |
| InChI | InChI=1S/C20H14F6N4OS2/c1-10-27-16(9-33-10)17(31)28-13-2-4-14(5-3-13)29-18(32)30-15-7-11(19(21,22)23)6-12(8-15)20(24,25)26/h2-9H,1H3,(H,28,31)(H2,29,30,32) |
| InChIKey | DFHFPGDHFBONRO-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|