C17H12F6N2OS — CID 19649247
1-(3-acetylphenyl)-3-[3,5-bis(trifluoromethyl)phenyl]thiourea (PubChem CID 19649247) has the molecular formula C17H12F6N2OS and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3,5-bis(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(3-acetylphenyl)-3-[3,5-bis(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19649247 |
| Molecular Formula | C17H12F6N2OS |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3,5-bis(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(=O)c1cccc(NC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H12F6N2OS/c1-9(26)10-3-2-4-13(5-10)24-15(27)25-14-7-11(16(18,19)20)6-12(8-14)17(21,22)23/h2-8H,1H3,(H2,24,25,27) |
| InChIKey | LIKGAYUCJQOXBV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|