C18H16F6N2S — CID 19649224
1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 19649224) has the molecular formula C18H16F6N2S and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 19649224 |
| Molecular Formula | C18H16F6N2S |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F6N2S/c1-10(2)11-3-5-14(6-4-11)25-16(27)26-15-8-12(17(19,20)21)7-13(9-15)18(22,23)24/h3-10H,1-2H3,(H2,25,26,27) |
| InChIKey | WCNGGPUKLXEPEE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|