C16H14ClF3N2O2S — CID 87655256
1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 87655256) has the molecular formula C16H14ClF3N2O2S and a molecular weight of 390.81 g/mol. Its IUPAC name is 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 87655256 |
| Molecular Formula | C16H14ClF3N2O2S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(O)c1cc(NC(=S)Nc2ccc(C(F)(F)F)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C16H14ClF3N2O2S/c1-8(23)12-6-11(7-13(17)14(12)24)22-15(25)21-10-4-2-9(3-5-10)16(18,19)20/h2-8,23-24H,1H3,(H2,21,22,25) |
| InChIKey | XFPFXZHCHKWLEG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|