C12H15F3N2OS — CID 115570489
1-(1-methoxypropan-2-yl)-3-[4-(trifluoromethyl)phenyl]thiourea (PubChem CID 115570489) has the molecular formula C12H15F3N2OS and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-[4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-[4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 115570489 |
| Molecular Formula | C12H15F3N2OS |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-[4-(trifluoromethyl)phenyl]thiourea |
| SMILES | COCC(C)NC(=S)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2OS/c1-8(7-18-2)16-11(19)17-10-5-3-9(4-6-10)12(13,14)15/h3-6,8H,7H2,1-2H3,(H2,16,17,19) |
| InChIKey | VYSRTWHXIZMLKH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|