C12H18N2O3S2 — CID 116507292
1-(1-methoxypropan-2-yl)-3-(4-methylsulfonylphenyl)thiourea (PubChem CID 116507292) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-3-(4-methylsulfonylphenyl)thiourea.
| Compound Name | 1-(1-methoxypropan-2-yl)-3-(4-methylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 116507292 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-3-(4-methylsulfonylphenyl)thiourea |
| SMILES | COCC(C)NC(=S)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-9(8-17-2)13-12(18)14-10-4-6-11(7-5-10)19(3,15)16/h4-7,9H,8H2,1-3H3,(H2,13,14,18) |
| InChIKey | NSGLOCBREIQGPN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|