C15H13Cl3N2O2S — CID 87656382
1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,5-dichlorophenyl)thiourea (PubChem CID 87656382) has the molecular formula C15H13Cl3N2O2S and a molecular weight of 391.71 g/mol. Its IUPAC name is 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,5-dichlorophenyl)thiourea.
| Compound Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 87656382 |
| Molecular Formula | C15H13Cl3N2O2S |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,5-dichlorophenyl)thiourea |
| SMILES | CC(O)c1cc(NC(=S)Nc2cc(Cl)cc(Cl)c2)cc(Cl)c1O |
| InChI | InChI=1S/C15H13Cl3N2O2S/c1-7(21)12-5-11(6-13(18)14(12)22)20-15(23)19-10-3-8(16)2-9(17)4-10/h2-7,21-22H,1H3,(H2,19,20,23) |
| InChIKey | RTWSUHUSYCFFBG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|