C18H21ClN2O6 — CID 69012883
1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 69012883) has the molecular formula C18H21ClN2O6 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 69012883 |
| Molecular Formula | C18H21ClN2O6 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[3-chloro-4-hydroxy-5-(1-hydroxyethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2cc(Cl)c(O)c(C(C)O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21ClN2O6/c1-9(22)12-5-10(6-13(19)16(12)23)20-18(24)21-11-7-14(25-2)17(27-4)15(8-11)26-3/h5-9,22-23H,1-4H3,(H2,20,21,24) |
| InChIKey | YASKBUSGIFKFQX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|