C10H11Cl2NO3 — CID 115875463
N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxypropanamide (PubChem CID 115875463) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxypropanamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 115875463 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-methoxypropanamide |
| SMILES | COC(C)C(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c1-5(16-2)10(15)13-6-3-7(11)9(14)8(12)4-6/h3-5,14H,1-2H3,(H,13,15) |
| InChIKey | RDTFXDBEZWKZCO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|