C12H13Cl2NO2 — CID 83154434
2-cyclopropyl-N-(3,5-dichloro-4-hydroxyphenyl)propanamide (PubChem CID 83154434) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is 2-cyclopropyl-N-(3,5-dichloro-4-hydroxyphenyl)propanamide.
| Compound Name | 2-cyclopropyl-N-(3,5-dichloro-4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 83154434 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 2-cyclopropyl-N-(3,5-dichloro-4-hydroxyphenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)c(O)c(Cl)c1)C1CC1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-6(7-2-3-7)12(17)15-8-4-9(13)11(16)10(14)5-8/h4-7,16H,2-3H2,1H3,(H,15,17) |
| InChIKey | HPCWCGZQXVGJOS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|