C9H8Cl3NO2 — CID 107679540
2-chloro-N-(3,5-dichloro-4-hydroxyphenyl)propanamide (PubChem CID 107679540) has the molecular formula C9H8Cl3NO2 and a molecular weight of 268.53 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-hydroxyphenyl)propanamide.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 107679540 |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-hydroxyphenyl)propanamide |
| SMILES | CC(Cl)C(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl3NO2/c1-4(10)9(15)13-5-2-6(11)8(14)7(12)3-5/h2-4,14H,1H3,(H,13,15) |
| InChIKey | XAOKEXJDLABXNU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|