C21H22F6N2S — CID 102145754
1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-hexylphenyl)thiourea (PubChem CID 102145754) has the molecular formula C21H22F6N2S and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-hexylphenyl)thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-hexylphenyl)thiourea |
|---|---|
| PubChem CID | 102145754 |
| Molecular Formula | C21H22F6N2S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-(4-hexylphenyl)thiourea |
| SMILES | CCCCCCc1ccc(NC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H22F6N2S/c1-2-3-4-5-6-14-7-9-17(10-8-14)28-19(30)29-18-12-15(20(22,23)24)11-16(13-18)21(25,26)27/h7-13H,2-6H2,1H3,(H2,28,29,30) |
| InChIKey | XGYKMMQWIXWHLS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|