C13H14F6N2S — CID 2797638
1-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylthiourea (PubChem CID 2797638) has the molecular formula C13H14F6N2S and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylthiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 2797638 |
| Molecular Formula | C13H14F6N2S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6N2S/c1-11(2,3)21-10(22)20-9-5-7(12(14,15)16)4-8(6-9)13(17,18)19/h4-6H,1-3H3,(H2,20,21,22) |
| InChIKey | RSNSNNFLPIBEIB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|