C17H20N2OS — CID 8684445
1-(4-ethylphenyl)-3-(2-phenoxyethyl)thiourea (PubChem CID 8684445) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(2-phenoxyethyl)thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-(2-phenoxyethyl)thiourea |
|---|---|
| PubChem CID | 8684445 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(2-phenoxyethyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2OS/c1-2-14-8-10-15(11-9-14)19-17(21)18-12-13-20-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H2,18,19,21) |
| InChIKey | DURFPEWFHLWWLY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|