C17H14N4O2S2 — CID 25173086
N-[(3-phenylmethoxyphenyl)carbamothioyl]thiadiazole-4-carboxamide (PubChem CID 25173086) has the molecular formula C17H14N4O2S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[(3-phenylmethoxyphenyl)carbamothioyl]thiadiazole-4-carboxamide.
| Compound Name | N-[(3-phenylmethoxyphenyl)carbamothioyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 25173086 |
| Molecular Formula | C17H14N4O2S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[(3-phenylmethoxyphenyl)carbamothioyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCc2ccccc2)c1)c1csnn1 |
| InChI | InChI=1S/C17H14N4O2S2/c22-16(15-11-25-21-20-15)19-17(24)18-13-7-4-8-14(9-13)23-10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H2,18,19,22,24) |
| InChIKey | SKLPOHZJMVDXGL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|