C26H21N3O4S2 — CID 59700700
2-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1,3-thiazole-4-carboxamide (PubChem CID 59700700) has the molecular formula C26H21N3O4S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59700700 |
| Molecular Formula | C26H21N3O4S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCc2ccccc2)c1)c1csc(C2COc3ccccc3O2)n1 |
| InChI | InChI=1S/C26H21N3O4S2/c30-24(20-16-35-25(28-20)23-15-32-21-11-4-5-12-22(21)33-23)29-26(34)27-18-9-6-10-19(13-18)31-14-17-7-2-1-3-8-17/h1-13,16,23H,14-15H2,(H2,27,29,30,34) |
| InChIKey | HYXAHSWZSQCVEE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|