C23H22N4O3S — CID 87447399
2-N,2-N-dimethyl-3-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-2,3-dicarboxamide (PubChem CID 87447399) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-3-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-2,3-dicarboxamide.
| Compound Name | 2-N,2-N-dimethyl-3-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 87447399 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-N,2-N-dimethyl-3-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-2,3-dicarboxamide |
| SMILES | CN(C)C(=O)c1ncccc1C(=O)NC(=S)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-27(2)22(29)20-19(12-7-13-24-20)21(28)26-23(31)25-17-10-6-11-18(14-17)30-15-16-8-4-3-5-9-16/h3-14H,15H2,1-2H3,(H2,25,26,28,31) |
| InChIKey | HOUIJBXNSGWTMI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|