C18H21N3O2S — CID 87958494
2-amino-2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]propanamide (PubChem CID 87958494) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]propanamide.
| Compound Name | 2-amino-2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 87958494 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-amino-2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]propanamide |
| SMILES | CC(C)(N)C(=O)NC(=S)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-18(2,19)16(22)21-17(24)20-14-9-6-10-15(11-14)23-12-13-7-4-3-5-8-13/h3-11H,12,19H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | UYVDZBCAMFUANK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|