C20H22N4O2S — CID 142677309
2,5-dimethyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1H-pyrazole-5-carboxamide (PubChem CID 142677309) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 2,5-dimethyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 142677309 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2,5-dimethyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-1H-pyrazole-5-carboxamide |
| SMILES | CN1C=CC(C)(C(=O)NC(=S)Nc2cccc(OCc3ccccc3)c2)N1 |
| InChI | InChI=1S/C20H22N4O2S/c1-20(11-12-24(2)23-20)18(25)22-19(27)21-16-9-6-10-17(13-16)26-14-15-7-4-3-5-8-15/h3-13,23H,14H2,1-2H3,(H2,21,22,25,27) |
| InChIKey | KHCIEXWHUSREMH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|