C23H29N3O2S — CID 59786839
2-(2,6-dimethylpiperidin-1-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]acetamide (PubChem CID 59786839) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 59786839 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-N-[(3-phenylmethoxyphenyl)carbamothioyl]acetamide |
| SMILES | CC1CCCC(C)N1CC(=O)NC(=S)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O2S/c1-17-8-6-9-18(2)26(17)15-22(27)25-23(29)24-20-12-7-13-21(14-20)28-16-19-10-4-3-5-11-19/h3-5,7,10-14,17-18H,6,8-9,15-16H2,1-2H3,(H2,24,25,27,29) |
| InChIKey | ZCSLRCVGPDVWBY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|