C17H15F3N2O2S — CID 174481521
2,2,2-trifluoro-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide (PubChem CID 174481521) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 174481521 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCCc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O2S/c18-17(19,20)15(23)22-16(25)21-13-7-4-8-14(11-13)24-10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H2,21,22,23,25) |
| InChIKey | XXSLWUKGQYCNJH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|