C20H16F3N3O3S — CID 59700703
2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 59700703) has the molecular formula C20H16F3N3O3S and a molecular weight of 435.43 g/mol. Its IUPAC name is 2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59700703 |
| Molecular Formula | C20H16F3N3O3S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-methyl-N-[(3-phenylmethoxyphenyl)carbamothioyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC(=S)Nc2cccc(OCc3ccccc3)c2)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C20H16F3N3O3S/c1-12-24-16(17(29-12)20(21,22)23)18(27)26-19(30)25-14-8-5-9-15(10-14)28-11-13-6-3-2-4-7-13/h2-10H,11H2,1H3,(H2,25,26,27,30) |
| InChIKey | ZXJCNVUGPPWNHO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|