C18H19F4N3O3S — CID 11654951
N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 11654951) has the molecular formula C18H19F4N3O3S and a molecular weight of 433.43 g/mol. Its IUPAC name is N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11654951 |
| Molecular Formula | C18H19F4N3O3S |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-2-methyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2nc(C)oc2C(F)(F)F)cc1F |
| InChI | InChI=1S/C18H19F4N3O3S/c1-3-4-5-8-27-13-7-6-11(9-12(13)19)24-17(29)25-16(26)14-15(18(20,21)22)28-10(2)23-14/h6-7,9H,3-5,8H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | HVLXLHABEVXBKT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|