C22H21F3N4O3S — CID 11691472
N-[(6-pentoxy-3-pyridinyl)carbamothioyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 11691472) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is N-[(6-pentoxy-3-pyridinyl)carbamothioyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(6-pentoxy-3-pyridinyl)carbamothioyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11691472 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-[(6-pentoxy-3-pyridinyl)carbamothioyl]-2-phenyl-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2nc(-c3ccccc3)oc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H21F3N4O3S/c1-2-3-7-12-31-16-11-10-15(13-26-16)27-21(33)29-19(30)17-18(22(23,24)25)32-20(28-17)14-8-5-4-6-9-14/h4-6,8-11,13H,2-3,7,12H2,1H3,(H2,27,29,30,33) |
| InChIKey | HQWRYMJUTKNBMH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|