C20H29N5O2S — CID 59786936
3-tert-butyl-1-methyl-N-[(6-pentoxy-3-pyridinyl)carbamothioyl]pyrazole-5-carboxamide (PubChem CID 59786936) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-N-[(6-pentoxy-3-pyridinyl)carbamothioyl]pyrazole-5-carboxamide.
| Compound Name | 3-tert-butyl-1-methyl-N-[(6-pentoxy-3-pyridinyl)carbamothioyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59786936 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-tert-butyl-1-methyl-N-[(6-pentoxy-3-pyridinyl)carbamothioyl]pyrazole-5-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2cc(C(C)(C)C)nn2C)cn1 |
| InChI | InChI=1S/C20H29N5O2S/c1-6-7-8-11-27-17-10-9-14(13-21-17)22-19(28)23-18(26)15-12-16(20(2,3)4)24-25(15)5/h9-10,12-13H,6-8,11H2,1-5H3,(H2,22,23,26,28) |
| InChIKey | CRLITGCDPQHNCC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|