C24H32N4O4S — CID 59700734
6-(2-morpholin-4-ylethoxy)-N-[(4-pentoxyphenyl)carbamothioyl]pyridine-3-carboxamide (PubChem CID 59700734) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethoxy)-N-[(4-pentoxyphenyl)carbamothioyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-morpholin-4-ylethoxy)-N-[(4-pentoxyphenyl)carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59700734 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 6-(2-morpholin-4-ylethoxy)-N-[(4-pentoxyphenyl)carbamothioyl]pyridine-3-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2ccc(OCCN3CCOCC3)nc2)cc1 |
| InChI | InChI=1S/C24H32N4O4S/c1-2-3-4-14-31-21-8-6-20(7-9-21)26-24(33)27-23(29)19-5-10-22(25-18-19)32-17-13-28-11-15-30-16-12-28/h5-10,18H,2-4,11-17H2,1H3,(H2,26,27,29,33) |
| InChIKey | PQBOVPSRWHJUPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|