C26H28N4O4S — CID 59700783
6-(2-morpholin-4-ylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-3-carboxamide (PubChem CID 59700783) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 6-(2-morpholin-4-ylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-morpholin-4-ylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 59700783 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 6-(2-morpholin-4-ylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCc2ccccc2)c1)c1ccc(OCCN2CCOCC2)nc1 |
| InChI | InChI=1S/C26H28N4O4S/c31-25(21-9-10-24(27-18-21)33-16-13-30-11-14-32-15-12-30)29-26(35)28-22-7-4-8-23(17-22)34-19-20-5-2-1-3-6-20/h1-10,17-18H,11-16,19H2,(H2,28,29,31,35) |
| InChIKey | RFVCTWGRANTATO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|