C24H32N4O3S — CID 87448499
2-(2-morpholin-4-ylethoxy)-N-[(4-pentylphenyl)carbamothioyl]pyridine-3-carboxamide (PubChem CID 87448499) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethoxy)-N-[(4-pentylphenyl)carbamothioyl]pyridine-3-carboxamide.
| Compound Name | 2-(2-morpholin-4-ylethoxy)-N-[(4-pentylphenyl)carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87448499 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-(2-morpholin-4-ylethoxy)-N-[(4-pentylphenyl)carbamothioyl]pyridine-3-carboxamide |
| SMILES | CCCCCc1ccc(NC(=S)NC(=O)c2cccnc2OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H32N4O3S/c1-2-3-4-6-19-8-10-20(11-9-19)26-24(32)27-22(29)21-7-5-12-25-23(21)31-18-15-28-13-16-30-17-14-28/h5,7-12H,2-4,6,13-18H2,1H3,(H2,26,27,29,32) |
| InChIKey | YVRFVLMRMPHIDB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|