C21H25N5OS — CID 21041716
2,7-dimethyl-N-[(4-pentylphenyl)carbamothioyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 21041716) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 2,7-dimethyl-N-[(4-pentylphenyl)carbamothioyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2,7-dimethyl-N-[(4-pentylphenyl)carbamothioyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 21041716 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2,7-dimethyl-N-[(4-pentylphenyl)carbamothioyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCc1ccc(NC(=S)NC(=O)c2cnc3cc(C)nn3c2C)cc1 |
| InChI | InChI=1S/C21H25N5OS/c1-4-5-6-7-16-8-10-17(11-9-16)23-21(28)24-20(27)18-13-22-19-12-14(2)25-26(19)15(18)3/h8-13H,4-7H2,1-3H3,(H2,23,24,27,28) |
| InChIKey | TVNGWSSPWVDGIH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|