C19H20N4O2S — CID 21041859
N-[(4-pentylphenyl)carbamothioyl]-2,1,3-benzoxadiazole-5-carboxamide (PubChem CID 21041859) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(4-pentylphenyl)carbamothioyl]-2,1,3-benzoxadiazole-5-carboxamide.
| Compound Name | N-[(4-pentylphenyl)carbamothioyl]-2,1,3-benzoxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 21041859 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(4-pentylphenyl)carbamothioyl]-2,1,3-benzoxadiazole-5-carboxamide |
| SMILES | CCCCCc1ccc(NC(=S)NC(=O)c2ccc3nonc3c2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-2-3-4-5-13-6-9-15(10-7-13)20-19(26)21-18(24)14-8-11-16-17(12-14)23-25-22-16/h6-12H,2-5H2,1H3,(H2,20,21,24,26) |
| InChIKey | VPXHZMAHWLYXDV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|