C23H28BrN3O3S — CID 46760746
3-bromo-4-butoxy-N-[[4-[3-(dimethylamino)-3-oxopropyl]phenyl]carbamothioyl]benzamide (PubChem CID 46760746) has the molecular formula C23H28BrN3O3S and a molecular weight of 506.47 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[[4-[3-(dimethylamino)-3-oxopropyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[[4-[3-(dimethylamino)-3-oxopropyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 46760746 |
| Molecular Formula | C23H28BrN3O3S |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-bromo-4-butoxy-N-[[4-[3-(dimethylamino)-3-oxopropyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccc(CCC(=O)N(C)C)cc2)cc1Br |
| InChI | InChI=1S/C23H28BrN3O3S/c1-4-5-14-30-20-12-9-17(15-19(20)24)22(29)26-23(31)25-18-10-6-16(7-11-18)8-13-21(28)27(2)3/h6-7,9-12,15H,4-5,8,13-14H2,1-3H3,(H2,25,26,29,31) |
| InChIKey | OYRVRJGTFDIACS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|