C17H21N3S — CID 8017252
1-(4-butylphenyl)-3-(5-methyl-2-pyridinyl)thiourea (PubChem CID 8017252) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(5-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(4-butylphenyl)-3-(5-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 8017252 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(4-butylphenyl)-3-(5-methyl-2-pyridinyl)thiourea |
| SMILES | CCCCc1ccc(NC(=S)Nc2ccc(C)cn2)cc1 |
| InChI | InChI=1S/C17H21N3S/c1-3-4-5-14-7-9-15(10-8-14)19-17(21)20-16-11-6-13(2)12-18-16/h6-12H,3-5H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | KXBHJGHWWMSLEC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|