C13H12FN3S — CID 19686070
1-(4-fluorophenyl)-3-(5-methyl-2-pyridinyl)thiourea (PubChem CID 19686070) has the molecular formula C13H12FN3S and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(5-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-(5-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 19686070 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(5-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C13H12FN3S/c1-9-2-7-12(15-8-9)17-13(18)16-11-5-3-10(14)4-6-11/h2-8H,1H3,(H2,15,16,17,18) |
| InChIKey | YMQXGOZUNSRQIU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|