C18H25N3OS — CID 19687443
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-butylphenyl)thiourea (PubChem CID 19687443) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-butylphenyl)thiourea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-butylphenyl)thiourea |
|---|---|
| PubChem CID | 19687443 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-butylphenyl)thiourea |
| SMILES | CCCCc1ccc(NC(=S)Nc2cc(C(C)(C)C)on2)cc1 |
| InChI | InChI=1S/C18H25N3OS/c1-5-6-7-13-8-10-14(11-9-13)19-17(23)20-16-12-15(22-21-16)18(2,3)4/h8-12H,5-7H2,1-4H3,(H2,19,20,21,23) |
| InChIKey | CQTUHQPXVXDAJY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|