C22H26N3O3P — CID 143052329
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(4-phosphanylphenyl)ethoxy]phenyl]urea (PubChem CID 143052329) has the molecular formula C22H26N3O3P and a molecular weight of 411.44 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(4-phosphanylphenyl)ethoxy]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(4-phosphanylphenyl)ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 143052329 |
| Molecular Formula | C22H26N3O3P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[2-(4-phosphanylphenyl)ethoxy]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(OCCc3ccc(P)cc3)cc2)no1 |
| InChI | InChI=1S/C22H26N3O3P/c1-22(2,3)19-14-20(25-28-19)24-21(26)23-16-6-8-17(9-7-16)27-13-12-15-4-10-18(29)11-5-15/h4-11,14H,12-13,29H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | UQNCSGZXWDPQHY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|