C24H31N3O3 — CID 143051889
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(4Z)-7-methyl-3-methylideneocta-4,6-dienoxy]phenyl]urea (PubChem CID 143051889) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(4Z)-7-methyl-3-methylideneocta-4,6-dienoxy]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(4Z)-7-methyl-3-methylideneocta-4,6-dienoxy]phenyl]urea |
|---|---|
| PubChem CID | 143051889 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[(4Z)-7-methyl-3-methylideneocta-4,6-dienoxy]phenyl]urea |
| SMILES | C=C(/C=C\C=C(C)C)CCOc1ccc(NC(=O)Nc2cc(C(C)(C)C)on2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-17(2)8-7-9-18(3)14-15-29-20-12-10-19(11-13-20)25-23(28)26-22-16-21(30-27-22)24(4,5)6/h7-13,16H,3,14-15H2,1-2,4-6H3,(H2,25,26,27,28)/b9-7- |
| InChIKey | ZEYXEKXVPPDCFN-CLFYSBASSA-N |
| XLogP | 6.46 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|