C15H19N3O3S — CID 59380965
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylsulfinylphenyl)urea (PubChem CID 59380965) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylsulfinylphenyl)urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylsulfinylphenyl)urea |
|---|---|
| PubChem CID | 59380965 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(4-methylsulfinylphenyl)urea |
| SMILES | CS(=O)c1ccc(NC(=O)Nc2cc(C(C)(C)C)on2)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-15(2,3)12-9-13(18-21-12)17-14(19)16-10-5-7-11(8-6-10)22(4)20/h5-9H,1-4H3,(H2,16,17,18,19) |
| InChIKey | QLURDPVZSPFUER-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |