C20H21N5O3 — CID 46883461
4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-pyridin-4-ylbenzamide (PubChem CID 46883461) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 46883461 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]-N-pyridin-4-ylbenzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C(=O)Nc3ccncc3)cc2)no1 |
| InChI | InChI=1S/C20H21N5O3/c1-20(2,3)16-12-17(25-28-16)24-19(27)23-14-6-4-13(5-7-14)18(26)22-15-8-10-21-11-9-15/h4-12H,1-3H3,(H,21,22,26)(H2,23,24,25,27) |
| InChIKey | RXQKYRGFBQTLGW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |