C15H17N3O4 — CID 59380957
4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]benzoic acid (PubChem CID 59380957) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]benzoic acid.
| Compound Name | 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 59380957 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]benzoic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C(=O)O)cc2)no1 |
| InChI | InChI=1S/C15H17N3O4/c1-15(2,3)11-8-12(18-22-11)17-14(21)16-10-6-4-9(5-7-10)13(19)20/h4-8H,1-3H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | VFUYZXMSUPPEGE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |