C16H19N3O4 — CID 108812303
4-[[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]methyl]benzoic acid (PubChem CID 108812303) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108812303 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-[[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]methyl]benzoic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)NCc2ccc(C(=O)O)cc2)no1 |
| InChI | InChI=1S/C16H19N3O4/c1-16(2,3)12-8-13(19-23-12)18-15(22)17-9-10-4-6-11(7-5-10)14(20)21/h4-8H,9H2,1-3H3,(H,20,21)(H2,17,18,19,22) |
| InChIKey | VJRPBGWYHRTEFE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |