C13H17N3O3 — CID 108812279
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(furan-2-ylmethyl)urea (PubChem CID 108812279) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 108812279 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(furan-2-ylmethyl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)NCc2ccco2)no1 |
| InChI | InChI=1S/C13H17N3O3/c1-13(2,3)10-7-11(16-19-10)15-12(17)14-8-9-5-4-6-18-9/h4-7H,8H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | AETJMKXUMFIEJK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |