C21H24N4O3 — CID 59381112
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-methoxyanilino)phenyl]urea (PubChem CID 59381112) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-methoxyanilino)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-methoxyanilino)phenyl]urea |
|---|---|
| PubChem CID | 59381112 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-methoxyanilino)phenyl]urea |
| SMILES | COc1ccc(Nc2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)cc2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-21(2,3)18-13-19(25-28-18)24-20(26)23-16-7-5-14(6-8-16)22-15-9-11-17(27-4)12-10-15/h5-13,22H,1-4H3,(H2,23,24,25,26) |
| InChIKey | DZRCPUVAEYURIB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |