C20H21N3O3 — CID 150862884
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-hydroxyphenyl)phenyl]urea (PubChem CID 150862884) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-hydroxyphenyl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-hydroxyphenyl)phenyl]urea |
|---|---|
| PubChem CID | 150862884 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(4-hydroxyphenyl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3ccc(O)cc3)cc2)no1 |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,3)17-12-18(23-26-17)22-19(25)21-15-8-4-13(5-9-15)14-6-10-16(24)11-7-14/h4-12,24H,1-3H3,(H2,21,22,23,25) |
| InChIKey | KSKMMUKQNZKECI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |