C21H23N5O4 — CID 87300976
N-[4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-2-pyridinyl]-N-methylformamide (PubChem CID 87300976) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-2-pyridinyl]-N-methylformamide.
| Compound Name | N-[4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-2-pyridinyl]-N-methylformamide |
|---|---|
| PubChem CID | 87300976 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[4-[4-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoylamino]phenoxy]-2-pyridinyl]-N-methylformamide |
| SMILES | CN(C=O)c1cc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)on3)cc2)ccn1 |
| InChI | InChI=1S/C21H23N5O4/c1-21(2,3)17-12-18(25-30-17)24-20(28)23-14-5-7-15(8-6-14)29-16-9-10-22-19(11-16)26(4)13-27/h5-13H,1-4H3,(H2,23,24,25,28) |
| InChIKey | WQBINBSJDBZNCF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|