C21H15BrClF3N4O3 — CID 87178743
N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]-2-chlorophenoxy]-2-pyridinyl]-N-methylformamide (PubChem CID 87178743) has the molecular formula C21H15BrClF3N4O3 and a molecular weight of 543.73 g/mol. Its IUPAC name is N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]-2-chlorophenoxy]-2-pyridinyl]-N-methylformamide.
| Compound Name | N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]-2-chlorophenoxy]-2-pyridinyl]-N-methylformamide |
|---|---|
| PubChem CID | 87178743 |
| Molecular Formula | C21H15BrClF3N4O3 |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]-2-chlorophenoxy]-2-pyridinyl]-N-methylformamide |
| SMILES | CN(C=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Br)c(C(F)(F)F)c3)cc2Cl)ccn1 |
| InChI | InChI=1S/C21H15BrClF3N4O3/c1-30(11-31)19-10-14(6-7-27-19)33-18-5-3-13(9-17(18)23)29-20(32)28-12-2-4-16(22)15(8-12)21(24,25)26/h2-11H,1H3,(H2,28,29,32) |
| InChIKey | ZLEKISCCSZHRRK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|